C22H25ClF2N4O2S — CID 134429602
4-[[(1S,2S)-2-(3-azabicyclo[3.1.0]hexan-3-yl)cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 134429602) has the molecular formula C22H25ClF2N4O2S and a molecular weight of 482.98 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-(3-azabicyclo[3.1.0]hexan-3-yl)cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[[(1S,2S)-2-(3-azabicyclo[3.1.0]hexan-3-yl)cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134429602 |
| Molecular Formula | C22H25ClF2N4O2S |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-[[(1S,2S)-2-(3-azabicyclo[3.1.0]hexan-3-yl)cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)n1)c1cc(Cl)c(N[C@H]2CCCC[C@@H]2N2CC3CC3C2)cc1F |
| InChI | InChI=1S/C22H25ClF2N4O2S/c23-15-9-20(32(30,31)28-22-7-3-6-21(25)27-22)16(24)10-18(15)26-17-4-1-2-5-19(17)29-11-13-8-14(13)12-29/h3,6-7,9-10,13-14,17,19,26H,1-2,4-5,8,11-12H2,(H,27,28)/t13?,14?,17-,19-/m0/s1 |
| InChIKey | GASHFJSCWZCKJV-YGDNTTNZSA-N |
| XLogP | 4.49 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|