C22H27ClF2N4O2S — CID 134429606
5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]amino]benzenesulfonamide (PubChem CID 134429606) has the molecular formula C22H27ClF2N4O2S and a molecular weight of 485.00 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]amino]benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 134429606 |
| Molecular Formula | C22H27ClF2N4O2S |
| Molecular Weight | 485.00 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)-4-[[(1R,2R)-2-piperidin-1-ylcyclohexyl]amino]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)n1)c1cc(Cl)c(N[C@@H]2CCCC[C@H]2N2CCCCC2)cc1F |
| InChI | InChI=1S/C22H27ClF2N4O2S/c23-15-13-20(32(30,31)28-22-10-6-9-21(25)27-22)16(24)14-18(15)26-17-7-2-3-8-19(17)29-11-4-1-5-12-29/h6,9-10,13-14,17,19,26H,1-5,7-8,11-12H2,(H,27,28)/t17-,19-/m1/s1 |
| InChIKey | XOXMSPLLZDPINB-IEBWSBKVSA-N |
| XLogP | 5.02 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.00 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|