C9H18N2 — CID 134429725
(1S,2S)-2-N,2-N,4-trimethylcyclohex-4-ene-1,2-diamine (PubChem CID 134429725) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (1S,2S)-2-N,2-N,4-trimethylcyclohex-4-ene-1,2-diamine.
| Compound Name | (1S,2S)-2-N,2-N,4-trimethylcyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 134429725 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (1S,2S)-2-N,2-N,4-trimethylcyclohex-4-ene-1,2-diamine |
| SMILES | CC1=CC[C@H](N)[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C9H18N2/c1-7-4-5-8(10)9(6-7)11(2)3/h4,8-9H,5-6,10H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | VZLUDHJNJZUBJE-IUCAKERBSA-N |
| XLogP | 0.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|