About 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol
2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol (PubChem CID 134429802) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol |
| PubChem CID | 134429802 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol |
| SMILES | CN(CCO)[C@H]1C[C@@H](C(F)(F)F)CC[C@@H]1N |
| InChI | InChI=1S/C10H19F3N2O/c1-15(4-5-16)9-6-7(10(11,12)13)2-3-8(9)14/h7-9,16H,2-6,14H2,1H3/t7-,8-,9-/m0/s1 |
| InChIKey | LMCULVABVBVITD-CIUDSAMLSA-N |
| XLogP | 0.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol?
The IUPAC name of 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol (CID 134429802) is 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol.
What is the SMILES notation for 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol?
The canonical SMILES for 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol is CN(CCO)[C@H]1C[C@@H](C(F)(F)F)CC[C@@H]1N.
What is the InChIKey of 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol?
The InChIKey is LMCULVABVBVITD-CIUDSAMLSA-N. The full InChI is InChI=1S/C10H19F3N2O/c1-15(4-5-16)9-6-7(10(11,12)13)2-3-8(9)14/h7-9,16H,2-6,14H2,1H3/t7-,8-,9-/m0/s1.
What are the key properties of 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol?
2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol has a molecular weight of 240.27 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,2S,5S)-2-amino-5-(trifluoromethyl)cyclohexyl]-methylamino]ethanol is sourced from PubChem (CID 134429802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).