C34H36F5N5O4S — CID 134429901
N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 134429901) has the molecular formula C34H36F5N5O4S and a molecular weight of 705.75 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 134429901 |
| Molecular Formula | C34H36F5N5O4S |
| Molecular Weight | 705.75 g/mol |
| Exact Mass | 705.24 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | COc1ccc(CN(c2ccncn2)S(=O)(=O)c2cc(F)c(N[C@H]3CC[C@H](c4cccc(C(F)(F)F)c4)C[C@@H]3N(C)C)cc2F)c(OC)c1 |
| InChI | InChI=1S/C34H36F5N5O4S/c1-43(2)30-15-22(21-6-5-7-24(14-21)34(37,38)39)9-11-28(30)42-29-17-27(36)32(18-26(29)35)49(45,46)44(33-12-13-40-20-41-33)19-23-8-10-25(47-3)16-31(23)48-4/h5-8,10,12-14,16-18,20,22,28,30,42H,9,11,15,19H2,1-4H3/t22-,28-,30-/m0/s1 |
| InChIKey | CRRYSHIAHUCEAT-XFHDSQNASA-N |
| XLogP | 6.86 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.75 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |