C26H30F2N4O4S — CID 134430450
(3S,6R)-2-[[4-[3,3-dimethoxy-1-(1H-1,2,4-triazol-5-yl)cyclobutyl]-2,5-difluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide (PubChem CID 134430450) has the molecular formula C26H30F2N4O4S and a molecular weight of 532.61 g/mol. Its IUPAC name is (3S,6R)-2-[[4-[3,3-dimethoxy-1-(1H-1,2,4-triazol-5-yl)cyclobutyl]-2,5-difluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide.
| Compound Name | (3S,6R)-2-[[4-[3,3-dimethoxy-1-(1H-1,2,4-triazol-5-yl)cyclobutyl]-2,5-difluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 134430450 |
| Molecular Formula | C26H30F2N4O4S |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (3S,6R)-2-[[4-[3,3-dimethoxy-1-(1H-1,2,4-triazol-5-yl)cyclobutyl]-2,5-difluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
| SMILES | COC1(OC)CC(c2ncn[nH]2)(c2cc(F)c(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)cc2F)C1 |
| InChI | InChI=1S/C26H30F2N4O4S/c1-17-9-10-23(18-7-5-4-6-8-18)37(33,34)32(17)13-19-11-22(28)20(12-21(19)27)25(24-29-16-30-31-24)14-26(15-25,35-2)36-3/h4-8,11-12,16-17,23H,9-10,13-15H2,1-3H3,(H,29,30,31)/t17-,23+/m0/s1 |
| InChIKey | VVAIXPFKLMHCIN-GAJHUEQPSA-N |
| XLogP | 4.21 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|