C20H28BrNO3 — CID 134430507
3-(3-bromophenoxy)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]cyclobutane-1-carboxamide (PubChem CID 134430507) has the molecular formula C20H28BrNO3 and a molecular weight of 410.35 g/mol. Its IUPAC name is 3-(3-bromophenoxy)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]cyclobutane-1-carboxamide.
| Compound Name | 3-(3-bromophenoxy)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 134430507 |
| Molecular Formula | C20H28BrNO3 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-(3-bromophenoxy)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]cyclobutane-1-carboxamide |
| SMILES | CC(C)(O)C1CCC(NC(=O)C2CC(Oc3cccc(Br)c3)C2)CC1 |
| InChI | InChI=1S/C20H28BrNO3/c1-20(2,24)14-6-8-16(9-7-14)22-19(23)13-10-18(11-13)25-17-5-3-4-15(21)12-17/h3-5,12-14,16,18,24H,6-11H2,1-2H3,(H,22,23) |
| InChIKey | SLXAQLGXNGYCKJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |