C10H16F2O — CID 134430544
(2E,4Z)-3-(difluoromethoxy)-4,6-dimethylhepta-2,4-diene (PubChem CID 134430544) has the molecular formula C10H16F2O and a molecular weight of 190.23 g/mol. Its IUPAC name is (2E,4Z)-3-(difluoromethoxy)-4,6-dimethylhepta-2,4-diene.
| Compound Name | (2E,4Z)-3-(difluoromethoxy)-4,6-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 134430544 |
| Molecular Formula | C10H16F2O |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2E,4Z)-3-(difluoromethoxy)-4,6-dimethylhepta-2,4-diene |
| SMILES | C/C=C(OC(F)F)\C(C)=C/C(C)C |
| InChI | InChI=1S/C10H16F2O/c1-5-9(13-10(11)12)8(4)6-7(2)3/h5-7,10H,1-4H3/b8-6-,9-5+ |
| InChIKey | VDBOKHKFHIQLRA-POEMVANMSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|