C17H17FN4O2 — CID 134430692
ethyl 2-(4-amino-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 134430692) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is ethyl 2-(4-amino-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(4-amino-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 134430692 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl 2-(4-amino-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)n2nc(-c3ccc(N)cc3F)cc2n1 |
| InChI | InChI=1S/C17H17FN4O2/c1-3-11-8-15(17(23)24-4-2)20-16-9-14(21-22(11)16)12-6-5-10(19)7-13(12)18/h5-9H,3-4,19H2,1-2H3 |
| InChIKey | UKDCUGQRBPJUMH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|