2-hydroxy-4,6-dinitrobenzoic acid

C7H4N2O7 — CID 13443185

IUPAC2-hydroxy-4,6-dinitrobenzoic acid
SMILESO=C(O)c1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C7H4N2O7/c10-5-2-3(8(13)14)1-4(9(15)16)6(5)7(11)12/h1-2,10H,(H,11,12)
InChIKeyAQBLBIVMAAUENI-UHFFFAOYSA-N
MW228.12 g/mol
LogP0.91
Rot. Bonds3

About 2-hydroxy-4,6-dinitrobenzoic acid

2-hydroxy-4,6-dinitrobenzoic acid (PubChem CID 13443185) has the molecular formula C7H4N2O7 and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-hydroxy-4,6-dinitrobenzoic acid.

Molecular Properties

Compound Name2-hydroxy-4,6-dinitrobenzoic acid
PubChem CID13443185
Molecular FormulaC7H4N2O7
Molecular Weight228.12 g/mol
Exact Mass228.00
IUPAC Name2-hydroxy-4,6-dinitrobenzoic acid
SMILESO=C(O)c1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C7H4N2O7/c10-5-2-3(8(13)14)1-4(9(15)16)6(5)7(11)12/h1-2,10H,(H,11,12)
InChIKeyAQBLBIVMAAUENI-UHFFFAOYSA-N
XLogP0.91
TPSA143.81 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.12
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hydroxy-4,6-dinitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-4,6-dinitrobenzoic acid?
The IUPAC name of 2-hydroxy-4,6-dinitrobenzoic acid (CID 13443185) is 2-hydroxy-4,6-dinitrobenzoic acid.
What is the SMILES notation for 2-hydroxy-4,6-dinitrobenzoic acid?
The canonical SMILES for 2-hydroxy-4,6-dinitrobenzoic acid is O=C(O)c1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-hydroxy-4,6-dinitrobenzoic acid?
The InChIKey is AQBLBIVMAAUENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O7/c10-5-2-3(8(13)14)1-4(9(15)16)6(5)7(11)12/h1-2,10H,(H,11,12).
What are the key properties of 2-hydroxy-4,6-dinitrobenzoic acid?
2-hydroxy-4,6-dinitrobenzoic acid has a molecular weight of 228.12 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,6-dinitrobenzoic acid is sourced from PubChem (CID 13443185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).