About 2-hydroxy-4,6-dinitrobenzoic acid
2-hydroxy-4,6-dinitrobenzoic acid (PubChem CID 13443185) has the molecular formula C7H4N2O7
and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-hydroxy-4,6-dinitrobenzoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-4,6-dinitrobenzoic acid |
| PubChem CID | 13443185 |
| Molecular Formula | C7H4N2O7 |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2-hydroxy-4,6-dinitrobenzoic acid |
| SMILES | O=C(O)c1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4N2O7/c10-5-2-3(8(13)14)1-4(9(15)16)6(5)7(11)12/h1-2,10H,(H,11,12) |
| InChIKey | AQBLBIVMAAUENI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4,6-dinitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4,6-dinitrobenzoic acid?
The IUPAC name of 2-hydroxy-4,6-dinitrobenzoic acid (CID 13443185) is 2-hydroxy-4,6-dinitrobenzoic acid.
What is the SMILES notation for 2-hydroxy-4,6-dinitrobenzoic acid?
The canonical SMILES for 2-hydroxy-4,6-dinitrobenzoic acid is O=C(O)c1c(O)cc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-hydroxy-4,6-dinitrobenzoic acid?
The InChIKey is AQBLBIVMAAUENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O7/c10-5-2-3(8(13)14)1-4(9(15)16)6(5)7(11)12/h1-2,10H,(H,11,12).
What are the key properties of 2-hydroxy-4,6-dinitrobenzoic acid?
2-hydroxy-4,6-dinitrobenzoic acid has a molecular weight of 228.12 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,6-dinitrobenzoic acid is sourced from PubChem (CID 13443185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).