C15H16N2O5 — CID 134431993
methyl 5-methoxy-2,2'-dioxospiro[1H-pyrrolo[2,3-b]pyridine-3,5'-cyclohexane]-1'-carboxylate (PubChem CID 134431993) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is methyl 5-methoxy-2,2'-dioxospiro[1H-pyrrolo[2,3-b]pyridine-3,5'-cyclohexane]-1'-carboxylate.
| Compound Name | methyl 5-methoxy-2,2'-dioxospiro[1H-pyrrolo[2,3-b]pyridine-3,5'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 134431993 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methyl 5-methoxy-2,2'-dioxospiro[1H-pyrrolo[2,3-b]pyridine-3,5'-cyclohexane]-1'-carboxylate |
| SMILES | COC(=O)C1CC2(CCC1=O)C(=O)Nc1ncc(OC)cc12 |
| InChI | InChI=1S/C15H16N2O5/c1-21-8-5-10-12(16-7-8)17-14(20)15(10)4-3-11(18)9(6-15)13(19)22-2/h5,7,9H,3-4,6H2,1-2H3,(H,16,17,20) |
| InChIKey | QGQFYEJTQBKYTR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|