C29H43AsO4 — CID 13443227
4,4',6,6'-tetratert-butyl-2-methyl-2,2'-spirobi[1,3,2lambda5-benzodioxarsole] (PubChem CID 13443227) has the molecular formula C29H43AsO4 and a molecular weight of 530.58 g/mol. Its IUPAC name is 4,4',6,6'-tetratert-butyl-2-methyl-2,2'-spirobi[1,3,2lambda5-benzodioxarsole].
| Compound Name | 4,4',6,6'-tetratert-butyl-2-methyl-2,2'-spirobi[1,3,2lambda5-benzodioxarsole] |
|---|---|
| PubChem CID | 13443227 |
| Molecular Formula | C29H43AsO4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 4,4',6,6'-tetratert-butyl-2-methyl-2,2'-spirobi[1,3,2lambda5-benzodioxarsole] |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)O[As]1(C)(O2)Oc2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C29H43AsO4/c1-26(2,3)18-14-20(28(7,8)9)24-22(16-18)31-30(13,33-24)32-23-17-19(27(4,5)6)15-21(25(23)34-30)29(10,11)12/h14-17H,1-13H3 |
| InChIKey | GSRAWDNOPAAMME-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|