C9H16OS — CID 13443250
3,5-diethylthian-4-one (PubChem CID 13443250) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is 3,5-diethylthian-4-one.
| Compound Name | 3,5-diethylthian-4-one |
|---|---|
| PubChem CID | 13443250 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 3,5-diethylthian-4-one |
| SMILES | CCC1CSCC(CC)C1=O |
| InChI | InChI=1S/C9H16OS/c1-3-7-5-11-6-8(4-2)9(7)10/h7-8H,3-6H2,1-2H3 |
| InChIKey | QHTJWVTWGBVJQM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |