About 2-phenylsulfanylbutane-1,4-diol
2-phenylsulfanylbutane-1,4-diol (PubChem CID 13443280) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-phenylsulfanylbutane-1,4-diol.
Molecular Properties
| Compound Name | 2-phenylsulfanylbutane-1,4-diol |
| PubChem CID | 13443280 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-phenylsulfanylbutane-1,4-diol |
| SMILES | OCCC(CO)Sc1ccccc1 |
| InChI | InChI=1S/C10H14O2S/c11-7-6-10(8-12)13-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | PHRYYCNCCSEDRV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylsulfanylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylbutane-1,4-diol?
The IUPAC name of 2-phenylsulfanylbutane-1,4-diol (CID 13443280) is 2-phenylsulfanylbutane-1,4-diol.
What is the SMILES notation for 2-phenylsulfanylbutane-1,4-diol?
The canonical SMILES for 2-phenylsulfanylbutane-1,4-diol is OCCC(CO)Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanylbutane-1,4-diol?
The InChIKey is PHRYYCNCCSEDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S/c11-7-6-10(8-12)13-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2.
What are the key properties of 2-phenylsulfanylbutane-1,4-diol?
2-phenylsulfanylbutane-1,4-diol has a molecular weight of 198.29 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylbutane-1,4-diol is sourced from PubChem (CID 13443280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).