C21H30O2S — CID 13443332
2-[(2E,6E)-2,6-dimethyl-8-phenylsulfanylocta-2,6-dienoxy]oxane (PubChem CID 13443332) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-[(2E,6E)-2,6-dimethyl-8-phenylsulfanylocta-2,6-dienoxy]oxane.
| Compound Name | 2-[(2E,6E)-2,6-dimethyl-8-phenylsulfanylocta-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 13443332 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[(2E,6E)-2,6-dimethyl-8-phenylsulfanylocta-2,6-dienoxy]oxane |
| SMILES | C/C(=C\CSc1ccccc1)CC/C=C(\C)COC1CCCCO1 |
| InChI | InChI=1S/C21H30O2S/c1-18(14-16-24-20-11-4-3-5-12-20)9-8-10-19(2)17-23-21-13-6-7-15-22-21/h3-5,10-12,14,21H,6-9,13,15-17H2,1-2H3/b18-14+,19-10+ |
| InChIKey | NXDROAFPPAEKOB-OEKAKLLGSA-N |
| XLogP | 5.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|