About (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine
(Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine (PubChem CID 134433392) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine |
| PubChem CID | 134433392 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine |
| SMILES | CCC(C)C(=C/CC(C)C)/C=N/C |
| InChI | InChI=1S/C12H23N/c1-6-11(4)12(9-13-5)8-7-10(2)3/h8-11H,6-7H2,1-5H3/b12-8+,13-9+ |
| InChIKey | WAARJDTXWJADIC-QHKWOANTSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine?
The IUPAC name of (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine (CID 134433392) is (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine.
What is the SMILES notation for (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine?
The canonical SMILES for (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine is CCC(C)C(=C/CC(C)C)/C=N/C.
What is the InChIKey of (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine?
The InChIKey is WAARJDTXWJADIC-QHKWOANTSA-N. The full InChI is InChI=1S/C12H23N/c1-6-11(4)12(9-13-5)8-7-10(2)3/h8-11H,6-7H2,1-5H3/b12-8+,13-9+.
What are the key properties of (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine?
(Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine has a molecular weight of 181.32 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-butan-2-yl-N,5-dimethylhex-2-en-1-imine is sourced from PubChem (CID 134433392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).