C13H11N3O6 — CID 134433696
2-[2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]phenoxy]acetic acid (PubChem CID 134433696) has the molecular formula C13H11N3O6 and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-[2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]phenoxy]acetic acid.
| Compound Name | 2-[2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 134433696 |
| Molecular Formula | C13H11N3O6 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1NC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H11N3O6/c17-10-5-8(15-13(21)16-10)12(20)14-7-3-1-2-4-9(7)22-6-11(18)19/h1-5H,6H2,(H,14,20)(H,18,19)(H2,15,16,17,21) |
| InChIKey | JDPSKEZCEBBNTL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |