About 2-tridecan-7-yl-4H-1,3-oxazol-5-one
2-tridecan-7-yl-4H-1,3-oxazol-5-one (PubChem CID 134433918) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is 2-tridecan-7-yl-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-tridecan-7-yl-4H-1,3-oxazol-5-one |
| PubChem CID | 134433918 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 2-tridecan-7-yl-4H-1,3-oxazol-5-one |
| SMILES | CCCCCCC(CCCCCC)C1=NCC(=O)O1 |
| InChI | InChI=1S/C16H29NO2/c1-3-5-7-9-11-14(12-10-8-6-4-2)16-17-13-15(18)19-16/h14H,3-13H2,1-2H3 |
| InChIKey | HGWCQANWSRXBJP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tridecan-7-yl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tridecan-7-yl-4H-1,3-oxazol-5-one?
The IUPAC name of 2-tridecan-7-yl-4H-1,3-oxazol-5-one (CID 134433918) is 2-tridecan-7-yl-4H-1,3-oxazol-5-one.
What is the SMILES notation for 2-tridecan-7-yl-4H-1,3-oxazol-5-one?
The canonical SMILES for 2-tridecan-7-yl-4H-1,3-oxazol-5-one is CCCCCCC(CCCCCC)C1=NCC(=O)O1.
What is the InChIKey of 2-tridecan-7-yl-4H-1,3-oxazol-5-one?
The InChIKey is HGWCQANWSRXBJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO2/c1-3-5-7-9-11-14(12-10-8-6-4-2)16-17-13-15(18)19-16/h14H,3-13H2,1-2H3.
What are the key properties of 2-tridecan-7-yl-4H-1,3-oxazol-5-one?
2-tridecan-7-yl-4H-1,3-oxazol-5-one has a molecular weight of 267.41 g/mol, XLogP of 4.50, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tridecan-7-yl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 134433918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).