C15H19N — CID 134433947
(4Z,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyridine (PubChem CID 134433947) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (4Z,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyridine.
| Compound Name | (4Z,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 134433947 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (4Z,5E)-4,5-di(ethylidene)-2-[(2E,4Z)-hexa-2,4-dien-3-yl]pyridine |
| SMILES | C/C=C\C(=C/C)c1cc(=C/C)/c(=C\C)cn1 |
| InChI | InChI=1S/C15H19N/c1-5-9-12(6-2)15-10-13(7-3)14(8-4)11-16-15/h5-11H,1-4H3/b9-5-,12-6+,13-7-,14-8- |
| InChIKey | JQKHAKFJLBVEQD-YKOXPIIVSA-N |
| XLogP | 2.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|