About 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane
3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 134435340) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane |
| PubChem CID | 134435340 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CN1C2CC1CN(F)C2 |
| InChI | InChI=1S/C6H11FN2/c1-8-5-2-6(8)4-9(7)3-5/h5-6H,2-4H2,1H3 |
| InChIKey | LBJJXWHJNQBAFT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane?
The IUPAC name of 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane (CID 134435340) is 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane.
What is the SMILES notation for 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane?
The canonical SMILES for 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane is CN1C2CC1CN(F)C2.
What is the InChIKey of 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane?
The InChIKey is LBJJXWHJNQBAFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2/c1-8-5-2-6(8)4-9(7)3-5/h5-6H,2-4H2,1H3.
What are the key properties of 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane?
3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane has a molecular weight of 130.17 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-methyl-3,6-diazabicyclo[3.1.1]heptane is sourced from PubChem (CID 134435340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).