C19H18N8O2 — CID 134435964
4-[6-[(4R)-3-azido-4-hydroxypyrrolidin-1-yl]-3-pyridinyl]-6-ethoxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 134435964) has the molecular formula C19H18N8O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 4-[6-[(4R)-3-azido-4-hydroxypyrrolidin-1-yl]-3-pyridinyl]-6-ethoxypyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 4-[6-[(4R)-3-azido-4-hydroxypyrrolidin-1-yl]-3-pyridinyl]-6-ethoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134435964 |
| Molecular Formula | C19H18N8O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[6-[(4R)-3-azido-4-hydroxypyrrolidin-1-yl]-3-pyridinyl]-6-ethoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CCOc1cc(-c2ccc(N3CC(N=[N+]=[N-])[C@H](O)C3)nc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C19H18N8O2/c1-2-29-14-5-15(19-13(6-20)8-23-27(19)9-14)12-3-4-18(22-7-12)26-10-16(24-25-21)17(28)11-26/h3-5,7-9,16-17,28H,2,10-11H2,1H3/t16?,17-/m1/s1 |
| InChIKey | KMAWPCZMQAXQTD-ZYMOGRSISA-N |
| XLogP | 2.53 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|