C33H37ClN8O4 — CID 134436495
6-chloro-N-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-(2-morpholin-4-ylethoxymethyl)piperidin-4-yl]pyridine-2-carboxamide (PubChem CID 134436495) has the molecular formula C33H37ClN8O4 and a molecular weight of 645.16 g/mol. Its IUPAC name is 6-chloro-N-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-(2-morpholin-4-ylethoxymethyl)piperidin-4-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-(2-morpholin-4-ylethoxymethyl)piperidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134436495 |
| Molecular Formula | C33H37ClN8O4 |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 6-chloro-N-[1-[5-(3-cyano-6-ethoxypyrazolo[1,5-a]pyridin-4-yl)-2-pyridinyl]-4-(2-morpholin-4-ylethoxymethyl)piperidin-4-yl]pyridine-2-carboxamide |
| SMILES | CCOc1cc(-c2ccc(N3CCC(COCCN4CCOCC4)(NC(=O)c4cccc(Cl)n4)CC3)nc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C33H37ClN8O4/c1-2-46-26-18-27(31-25(19-35)21-37-42(31)22-26)24-6-7-30(36-20-24)41-10-8-33(9-11-41,23-45-17-14-40-12-15-44-16-13-40)39-32(43)28-4-3-5-29(34)38-28/h3-7,18,20-22H,2,8-17,23H2,1H3,(H,39,43) |
| InChIKey | NICNJPDVVOQEQT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|