C27H25F3N6O2 — CID 134436794
4-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-6-[2-(trifluoromethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 134436794) has the molecular formula C27H25F3N6O2 and a molecular weight of 522.53 g/mol. Its IUPAC name is 4-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-6-[2-(trifluoromethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 4-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-6-[2-(trifluoromethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134436794 |
| Molecular Formula | C27H25F3N6O2 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 4-[6-(4-benzylpiperazin-1-yl)-3-pyridinyl]-6-[2-(trifluoromethoxy)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnn2cc(OCCOC(F)(F)F)cc(-c3ccc(N4CCN(Cc5ccccc5)CC4)nc3)c12 |
| InChI | InChI=1S/C27H25F3N6O2/c28-27(29,30)38-13-12-37-23-14-24(26-22(15-31)17-33-36(26)19-23)21-6-7-25(32-16-21)35-10-8-34(9-11-35)18-20-4-2-1-3-5-20/h1-7,14,16-17,19H,8-13,18H2 |
| InChIKey | IGSIFVBYDVPLOL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|