C22H32ClF3N4O3 — CID 134437313
2-chloro-6-[4-[3-[[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 134437313) has the molecular formula C22H32ClF3N4O3 and a molecular weight of 492.97 g/mol. Its IUPAC name is 2-chloro-6-[4-[3-[[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[4-[3-[[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134437313 |
| Molecular Formula | C22H32ClF3N4O3 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 2-chloro-6-[4-[3-[[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CC(C)C(O)(C(=O)NCCCC1CCN(c2ccc(C(=O)N(C)C)c(Cl)n2)CC1)C(F)(F)F |
| InChI | InChI=1S/C22H32ClF3N4O3/c1-14(2)21(33,22(24,25)26)20(32)27-11-5-6-15-9-12-30(13-10-15)17-8-7-16(18(23)28-17)19(31)29(3)4/h7-8,14-15,33H,5-6,9-13H2,1-4H3,(H,27,32) |
| InChIKey | GRHXDFLBHJOCQF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|