C31H23F7O — CID 134437850
5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene (PubChem CID 134437850) has the molecular formula C31H23F7O and a molecular weight of 544.51 g/mol. Its IUPAC name is 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 134437850 |
| Molecular Formula | C31H23F7O |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-2-propyl-2,3-dihydro-1H-indene |
| SMILES | CCCC1Cc2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)cc3)cc2C1 |
| InChI | InChI=1S/C31H23F7O/c1-2-3-17-10-20-8-9-21(12-22(20)11-17)18-4-6-19(7-5-18)23-13-25(32)29(26(33)14-23)31(37,38)39-24-15-27(34)30(36)28(35)16-24/h4-9,12-17H,2-3,10-11H2,1H3 |
| InChIKey | GOANKOVRNVTVEB-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|