C27H45NO — CID 134437947
(NZ)-N-(1,5,9,19,20-pentamethyl-18-tetracyclo[12.8.0.02,11.05,10]docos-11-enylidene)hydroxylamine (PubChem CID 134437947) has the molecular formula C27H45NO and a molecular weight of 399.66 g/mol. Its IUPAC name is (NZ)-N-(1,5,9,19,20-pentamethyl-18-tetracyclo[12.8.0.02,11.05,10]docos-11-enylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1,5,9,19,20-pentamethyl-18-tetracyclo[12.8.0.02,11.05,10]docos-11-enylidene)hydroxylamine |
|---|---|
| PubChem CID | 134437947 |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | (NZ)-N-(1,5,9,19,20-pentamethyl-18-tetracyclo[12.8.0.02,11.05,10]docos-11-enylidene)hydroxylamine |
| SMILES | CC1CCC2(C)C(CC=C3C4C(C)CCCC4(C)CCC32)CCC/C(=N/O)C1C |
| InChI | InChI=1S/C27H45NO/c1-18-13-17-27(5)21(9-6-10-24(28-29)20(18)3)11-12-22-23(27)14-16-26(4)15-7-8-19(2)25(22)26/h12,18-21,23,25,29H,6-11,13-17H2,1-5H3/b28-24- |
| InChIKey | DVBXTQMGYJJGDX-COOPMVRXSA-N |
| XLogP | 7.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|