About 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine
5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine (PubChem CID 134438050) has the molecular formula C7H14FNO
and a molecular weight of 147.19 g/mol. Its IUPAC name is 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine |
| PubChem CID | 134438050 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine |
| SMILES | CN1CC(CF)OC1(C)C |
| InChI | InChI=1S/C7H14FNO/c1-7(2)9(3)5-6(4-8)10-7/h6H,4-5H2,1-3H3 |
| InChIKey | KKKFFKSRYQIUPY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine?
The IUPAC name of 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine (CID 134438050) is 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine.
What is the SMILES notation for 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine?
The canonical SMILES for 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine is CN1CC(CF)OC1(C)C.
What is the InChIKey of 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine?
The InChIKey is KKKFFKSRYQIUPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FNO/c1-7(2)9(3)5-6(4-8)10-7/h6H,4-5H2,1-3H3.
What are the key properties of 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine?
5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine has a molecular weight of 147.19 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(fluoromethyl)-2,2,3-trimethyl-1,3-oxazolidine is sourced from PubChem (CID 134438050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).