C24H28N4O — CID 134438080
(E)-1-[(3aR,6aS)-2-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-en-1-one (PubChem CID 134438080) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (E)-1-[(3aR,6aS)-2-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3aR,6aS)-2-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134438080 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (E)-1-[(3aR,6aS)-2-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)prop-2-en-1-one |
| SMILES | Cc1ccccc1N1C[C@H]2CN(C(=O)/C=C/c3cnc4c(c3)CCCN4)C[C@H]2C1 |
| InChI | InChI=1S/C24H28N4O/c1-17-5-2-3-7-22(17)27-13-20-15-28(16-21(20)14-27)23(29)9-8-18-11-19-6-4-10-25-24(19)26-12-18/h2-3,5,7-9,11-12,20-21H,4,6,10,13-16H2,1H3,(H,25,26)/b9-8+/t20-,21+ |
| InChIKey | KYAUYRBRBGBFMX-ROSYVIOISA-N |
| XLogP | 3.36 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|