About (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine
(2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine (PubChem CID 134438457) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine.
Molecular Properties
| Compound Name | (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine |
| PubChem CID | 134438457 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine |
| SMILES | C=CC(=C)C(=C)/C(=C\C)N(C)C=C |
| InChI | InChI=1S/C12H17N/c1-7-10(4)11(5)12(8-2)13(6)9-3/h7-9H,1,3-5H2,2,6H3/b12-8+ |
| InChIKey | VQOIWIOFVIMBOM-XYOKQWHBSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine?
The IUPAC name of (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine (CID 134438457) is (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine.
What is the SMILES notation for (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine?
The canonical SMILES for (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine is C=CC(=C)C(=C)/C(=C\C)N(C)C=C.
What is the InChIKey of (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine?
The InChIKey is VQOIWIOFVIMBOM-XYOKQWHBSA-N. The full InChI is InChI=1S/C12H17N/c1-7-10(4)11(5)12(8-2)13(6)9-3/h7-9H,1,3-5H2,2,6H3/b12-8+.
What are the key properties of (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine?
(2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine has a molecular weight of 175.27 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-ethenyl-N-methyl-4,5-dimethylidenehepta-2,6-dien-3-amine is sourced from PubChem (CID 134438457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).