C14H25F3N2 — CID 134438486
(1R,2R)-1-N,1-N-dimethyl-2-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine (PubChem CID 134438486) has the molecular formula C14H25F3N2 and a molecular weight of 278.36 g/mol. Its IUPAC name is (1R,2R)-1-N,1-N-dimethyl-2-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine.
| Compound Name | (1R,2R)-1-N,1-N-dimethyl-2-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 134438486 |
| Molecular Formula | C14H25F3N2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (1R,2R)-1-N,1-N-dimethyl-2-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine |
| SMILES | CCC(C)(C)N[C@@H]1CC(C(F)(F)F)=CC[C@H]1N(C)C |
| InChI | InChI=1S/C14H25F3N2/c1-6-13(2,3)18-11-9-10(14(15,16)17)7-8-12(11)19(4)5/h7,11-12,18H,6,8-9H2,1-5H3/t11-,12-/m1/s1 |
| InChIKey | VWXIVRKUHSXSAY-VXGBXAGGSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|