C16H14ClN7O — CID 134438910
6-chloro-1-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]pyrazolo[4,3-c]pyridin-3-amine (PubChem CID 134438910) has the molecular formula C16H14ClN7O and a molecular weight of 355.79 g/mol. Its IUPAC name is 6-chloro-1-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]pyrazolo[4,3-c]pyridin-3-amine.
| Compound Name | 6-chloro-1-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]pyrazolo[4,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 134438910 |
| Molecular Formula | C16H14ClN7O |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 6-chloro-1-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]pyrazolo[4,3-c]pyridin-3-amine |
| SMILES | COc1c(-c2ncn(C)n2)cccc1-n1nc(N)c2cnc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClN7O/c1-23-8-20-16(22-23)9-4-3-5-11(14(9)25-2)24-12-6-13(17)19-7-10(12)15(18)21-24/h3-8H,1-2H3,(H2,18,21) |
| InChIKey | ZDUOEQYVBVYVKG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|