About ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate
ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate (PubChem CID 134439409) has the molecular formula C14H19F3N2O3
and a molecular weight of 320.31 g/mol. Its IUPAC name is ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate |
| PubChem CID | 134439409 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C(CC(F)(F)F)C(=O)c1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19F3N2O3/c1-5-22-12(21)10(6-14(15,16)17)11(20)9-7-18-19(8-9)13(2,3)4/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | YQQXOGAICFEIJB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate?
The IUPAC name of ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate (CID 134439409) is ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate.
What is the SMILES notation for ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate?
The canonical SMILES for ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate is CCOC(=O)C(CC(F)(F)F)C(=O)c1cnn(C(C)(C)C)c1.
What is the InChIKey of ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate?
The InChIKey is YQQXOGAICFEIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O3/c1-5-22-12(21)10(6-14(15,16)17)11(20)9-7-18-19(8-9)13(2,3)4/h7-8,10H,5-6H2,1-4H3.
What are the key properties of ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate?
ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate has a molecular weight of 320.31 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1-tert-butylpyrazole-4-carbonyl)-4,4,4-trifluorobutanoate is sourced from PubChem (CID 134439409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).