C29H30FN7O — CID 134440201
6-(3,5-dimethylpyrazol-1-yl)-N-[4-ethyl-5-(4-fluorophenyl)-1-(2-phenylmethoxyethyl)pyrazol-3-yl]pyrimidin-4-amine (PubChem CID 134440201) has the molecular formula C29H30FN7O and a molecular weight of 511.61 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-N-[4-ethyl-5-(4-fluorophenyl)-1-(2-phenylmethoxyethyl)pyrazol-3-yl]pyrimidin-4-amine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-N-[4-ethyl-5-(4-fluorophenyl)-1-(2-phenylmethoxyethyl)pyrazol-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134440201 |
| Molecular Formula | C29H30FN7O |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-N-[4-ethyl-5-(4-fluorophenyl)-1-(2-phenylmethoxyethyl)pyrazol-3-yl]pyrimidin-4-amine |
| SMILES | CCc1c(Nc2cc(-n3nc(C)cc3C)ncn2)nn(CCOCc2ccccc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H30FN7O/c1-4-25-28(23-10-12-24(30)13-11-23)36(14-15-38-18-22-8-6-5-7-9-22)35-29(25)33-26-17-27(32-19-31-26)37-21(3)16-20(2)34-37/h5-13,16-17,19H,4,14-15,18H2,1-3H3,(H,31,32,33,35) |
| InChIKey | IQHGPCYOHWLDOQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|