C13H20N2O — CID 13444051
3,4-dimethyl-1-morpholin-4-ylcyclohex-3-ene-1-carbonitrile (PubChem CID 13444051) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3,4-dimethyl-1-morpholin-4-ylcyclohex-3-ene-1-carbonitrile.
| Compound Name | 3,4-dimethyl-1-morpholin-4-ylcyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 13444051 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3,4-dimethyl-1-morpholin-4-ylcyclohex-3-ene-1-carbonitrile |
| SMILES | CC1=C(C)CC(C#N)(N2CCOCC2)CC1 |
| InChI | InChI=1S/C13H20N2O/c1-11-3-4-13(10-14,9-12(11)2)15-5-7-16-8-6-15/h3-9H2,1-2H3 |
| InChIKey | PJXPEIFLMMNLOD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|