C19H26N2O3 — CID 134441154
tert-butyl 6-[(4aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]pyridine-3-carboxylate (PubChem CID 134441154) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 6-[(4aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 6-[(4aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134441154 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 6-[(4aR)-6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N2CC[C@@H]3CC(=O)CCC3C2)nc1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,3)24-18(23)14-5-7-17(20-11-14)21-9-8-13-10-16(22)6-4-15(13)12-21/h5,7,11,13,15H,4,6,8-10,12H2,1-3H3/t13-,15?/m1/s1 |
| InChIKey | BXYFJUJAKNNFLS-AFYYWNPRSA-N |
| XLogP | 3.23 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |