About N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline
N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline (PubChem CID 134441588) has the molecular formula C21H23Cl2N
and a molecular weight of 360.33 g/mol. Its IUPAC name is N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline |
| PubChem CID | 134441588 |
| Molecular Formula | C21H23Cl2N |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline |
| SMILES | C=C(Nc1ccc(C)c(C)c1)C1C(c2cc(C)cc(Cl)c2)C1(C)Cl |
| InChI | InChI=1S/C21H23Cl2N/c1-12-8-16(11-17(22)9-12)20-19(21(20,5)23)15(4)24-18-7-6-13(2)14(3)10-18/h6-11,19-20,24H,4H2,1-3,5H3 |
| InChIKey | WOCOJZJKHDDRAC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline?
The IUPAC name of N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline (CID 134441588) is N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline.
What is the SMILES notation for N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline?
The canonical SMILES for N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline is C=C(Nc1ccc(C)c(C)c1)C1C(c2cc(C)cc(Cl)c2)C1(C)Cl.
What is the InChIKey of N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline?
The InChIKey is WOCOJZJKHDDRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N/c1-12-8-16(11-17(22)9-12)20-19(21(20,5)23)15(4)24-18-7-6-13(2)14(3)10-18/h6-11,19-20,24H,4H2,1-3,5H3.
What are the key properties of N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline?
N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline has a molecular weight of 360.33 g/mol, XLogP of 6.60, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-chloro-3-(3-chloro-5-methylphenyl)-2-methylcyclopropyl]ethenyl]-3,4-dimethylaniline is sourced from PubChem (CID 134441588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).