C9H8F4N2 — CID 134442051
4-fluoro-3-N-(3,3,3-trifluoroprop-1-en-2-yl)benzene-1,3-diamine (PubChem CID 134442051) has the molecular formula C9H8F4N2 and a molecular weight of 220.17 g/mol. Its IUPAC name is 4-fluoro-3-N-(3,3,3-trifluoroprop-1-en-2-yl)benzene-1,3-diamine.
| Compound Name | 4-fluoro-3-N-(3,3,3-trifluoroprop-1-en-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 134442051 |
| Molecular Formula | C9H8F4N2 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4-fluoro-3-N-(3,3,3-trifluoroprop-1-en-2-yl)benzene-1,3-diamine |
| SMILES | C=C(Nc1cc(N)ccc1F)C(F)(F)F |
| InChI | InChI=1S/C9H8F4N2/c1-5(9(11,12)13)15-8-4-6(14)2-3-7(8)10/h2-4,15H,1,14H2 |
| InChIKey | RYLINUGPWVHJRQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|