About 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate
4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate (PubChem CID 134442562) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate |
| PubChem CID | 134442562 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate |
| SMILES | COC(=O)C1=CC[C@@H](C(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C14H22O4/c1-9-8-10(12(15)17-5)6-7-11(9)13(16)18-14(2,3)4/h6,9,11H,7-8H2,1-5H3/t9-,11+/m0/s1 |
| InChIKey | FARBNAPIZLJJCX-GXSJLCMTSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate?
The IUPAC name of 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate (CID 134442562) is 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate.
What is the SMILES notation for 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate?
The canonical SMILES for 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate is COC(=O)C1=CC[C@@H](C(=O)OC(C)(C)C)[C@@H](C)C1.
What is the InChIKey of 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate?
The InChIKey is FARBNAPIZLJJCX-GXSJLCMTSA-N. The full InChI is InChI=1S/C14H22O4/c1-9-8-10(12(15)17-5)6-7-11(9)13(16)18-14(2,3)4/h6,9,11H,7-8H2,1-5H3/t9-,11+/m0/s1.
What are the key properties of 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate?
4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate has a molecular weight of 254.33 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-methyl (4R,5S)-5-methylcyclohexene-1,4-dicarboxylate is sourced from PubChem (CID 134442562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).