C17H17FN2O3S — CID 134442566
9b-(4-fluorophenyl)sulfonyl-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[3,2-f]quinolin-7-one (PubChem CID 134442566) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is 9b-(4-fluorophenyl)sulfonyl-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[3,2-f]quinolin-7-one.
| Compound Name | 9b-(4-fluorophenyl)sulfonyl-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[3,2-f]quinolin-7-one |
|---|---|
| PubChem CID | 134442566 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 9b-(4-fluorophenyl)sulfonyl-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[3,2-f]quinolin-7-one |
| SMILES | O=c1ccc2c([nH]1)CCC1NCCC21S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O3S/c18-11-1-3-12(4-2-11)24(22,23)17-9-10-19-15(17)7-6-14-13(17)5-8-16(21)20-14/h1-5,8,15,19H,6-7,9-10H2,(H,20,21) |
| InChIKey | RVIYHKHTTIOYKD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |