About 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine
2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine (PubChem CID 134442647) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine.
Molecular Properties
| Compound Name | 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine |
| PubChem CID | 134442647 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine |
| SMILES | C=c1cc[nH]c(=C)nc(C(C)CCC)cc1 |
| InChI | InChI=1S/C14H20N2/c1-5-6-12(3)14-8-7-11(2)9-10-15-13(4)16-14/h7-10,12,15H,2,4-6H2,1,3H3/b8-7-,10-9-,16-14+ |
| InChIKey | OPPKVBFPUPDAGD-BQCGHWIMSA-N |
| XLogP | 2.26 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine?
The IUPAC name of 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine (CID 134442647) is 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine.
What is the SMILES notation for 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine?
The canonical SMILES for 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine is C=c1cc[nH]c(=C)nc(C(C)CCC)cc1.
What is the InChIKey of 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine?
The InChIKey is OPPKVBFPUPDAGD-BQCGHWIMSA-N. The full InChI is InChI=1S/C14H20N2/c1-5-6-12(3)14-8-7-11(2)9-10-15-13(4)16-14/h7-10,12,15H,2,4-6H2,1,3H3/b8-7-,10-9-,16-14+.
What are the key properties of 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine?
2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine has a molecular weight of 216.33 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylidene-4-pentan-2-yl-1H-1,3-diazonine is sourced from PubChem (CID 134442647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).