C60H54N2 — CID 134442782
2-[4-(4a,11,11-trimethyl-11aH-benzo[b]fluoren-5-yl)phenyl]-N-(9,9-dimethyl-4b,5-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-2H-pyrrol-5-amine (PubChem CID 134442782) has the molecular formula C60H54N2 and a molecular weight of 803.11 g/mol. Its IUPAC name is 2-[4-(4a,11,11-trimethyl-11aH-benzo[b]fluoren-5-yl)phenyl]-N-(9,9-dimethyl-4b,5-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-2H-pyrrol-5-amine.
| Compound Name | 2-[4-(4a,11,11-trimethyl-11aH-benzo[b]fluoren-5-yl)phenyl]-N-(9,9-dimethyl-4b,5-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 134442782 |
| Molecular Formula | C60H54N2 |
| Molecular Weight | 803.11 g/mol |
| Exact Mass | 802.43 |
| IUPAC Name | 2-[4-(4a,11,11-trimethyl-11aH-benzo[b]fluoren-5-yl)phenyl]-N-(9,9-dimethyl-4b,5-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-2H-pyrrol-5-amine |
| SMILES | CC1(C)C2=CC=CCC2c2ccc(N(C3=NC(c4ccc(-c5c6c(cc7ccccc57)C(C)(C)C5C=CC=CC65C)cc4)C=C3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C60H54N2/c1-57(2)47-20-12-10-18-43(47)45-29-27-40(35-49(45)57)62(41-28-30-46-44-19-11-13-21-48(44)58(3,4)50(46)36-41)54-32-31-52(61-54)37-23-25-38(26-24-37)55-42-17-9-8-16-39(42)34-51-56(55)60(7)33-15-14-22-53(60)59(51,5)6/h8-18,20-36,44,52-53H,19H2,1-7H3 |
| InChIKey | UYDIZLZWDKZTGT-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.11 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |