About 2-(4H-pyran-2-yl)-1,4-dihydropyridine
2-(4H-pyran-2-yl)-1,4-dihydropyridine (PubChem CID 134442805) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(4H-pyran-2-yl)-1,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-(4H-pyran-2-yl)-1,4-dihydropyridine |
| PubChem CID | 134442805 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(4H-pyran-2-yl)-1,4-dihydropyridine |
| SMILES | C1=CNC(C2=CCC=CO2)=CC1 |
| InChI | InChI=1S/C10H11NO/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h3-8,11H,1-2H2 |
| InChIKey | UXEHTXGMHLQQHS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4H-pyran-2-yl)-1,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4H-pyran-2-yl)-1,4-dihydropyridine?
The IUPAC name of 2-(4H-pyran-2-yl)-1,4-dihydropyridine (CID 134442805) is 2-(4H-pyran-2-yl)-1,4-dihydropyridine.
What is the SMILES notation for 2-(4H-pyran-2-yl)-1,4-dihydropyridine?
The canonical SMILES for 2-(4H-pyran-2-yl)-1,4-dihydropyridine is C1=CNC(C2=CCC=CO2)=CC1.
What is the InChIKey of 2-(4H-pyran-2-yl)-1,4-dihydropyridine?
The InChIKey is UXEHTXGMHLQQHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h3-8,11H,1-2H2.
What are the key properties of 2-(4H-pyran-2-yl)-1,4-dihydropyridine?
2-(4H-pyran-2-yl)-1,4-dihydropyridine has a molecular weight of 161.20 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4H-pyran-2-yl)-1,4-dihydropyridine is sourced from PubChem (CID 134442805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).