C12H11Cl2FNO3S- — CID 134443166
[4-[(4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate (PubChem CID 134443166) has the molecular formula C12H11Cl2FNO3S- and a molecular weight of 339.20 g/mol. Its IUPAC name is [4-[(4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate.
| Compound Name | [4-[(4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 134443166 |
| Molecular Formula | C12H11Cl2FNO3S- |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | [4-[(4S,5R)-2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate |
| SMILES | O=S([O-])Cc1ccc([C@H]2OC(C(Cl)Cl)=N[C@@H]2CF)cc1 |
| InChI | InChI=1S/C12H12Cl2FNO3S/c13-11(14)12-16-9(5-15)10(19-12)8-3-1-7(2-4-8)6-20(17)18/h1-4,9-11H,5-6H2,(H,17,18)/p-1/t9-,10-/m1/s1 |
| InChIKey | MBTLGASBTBNIJB-NXEZZACHSA-M |
| XLogP | 2.68 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|