C11H14N2 — CID 134443430
N'-buta-1,3-dien-2-yl-N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidamide (PubChem CID 134443430) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N'-buta-1,3-dien-2-yl-N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidamide.
| Compound Name | N'-buta-1,3-dien-2-yl-N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 134443430 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N'-buta-1,3-dien-2-yl-N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidamide |
| SMILES | C=C/C=C\C(=C)N/C=N/C(=C)C=C |
| InChI | InChI=1S/C11H14N2/c1-5-7-8-11(4)13-9-12-10(3)6-2/h5-9H,1-4H2,(H,12,13)/b8-7- |
| InChIKey | CFNMTCIJSYNZDU-FPLPWBNLSA-N |
| XLogP | 2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|