C22H44S — CID 134443444
8,8-dimethyl-7-methylidene-1-(2,2,6-trimethylheptan-4-ylsulfanyl)nonane (PubChem CID 134443444) has the molecular formula C22H44S and a molecular weight of 340.66 g/mol. Its IUPAC name is 8,8-dimethyl-7-methylidene-1-(2,2,6-trimethylheptan-4-ylsulfanyl)nonane.
| Compound Name | 8,8-dimethyl-7-methylidene-1-(2,2,6-trimethylheptan-4-ylsulfanyl)nonane |
|---|---|
| PubChem CID | 134443444 |
| Molecular Formula | C22H44S |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 340.32 |
| IUPAC Name | 8,8-dimethyl-7-methylidene-1-(2,2,6-trimethylheptan-4-ylsulfanyl)nonane |
| SMILES | C=C(CCCCCCSC(CC(C)C)CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H44S/c1-18(2)16-20(17-21(4,5)6)23-15-13-11-10-12-14-19(3)22(7,8)9/h18,20H,3,10-17H2,1-2,4-9H3 |
| InChIKey | TZUPTQZFJBUEOW-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|