C14H22N2 — CID 134443678
1-(4-methylcyclohexa-1,3-dien-1-yl)-N-propylbutane-1,4-diimine (PubChem CID 134443678) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-1,3-dien-1-yl)-N-propylbutane-1,4-diimine.
| Compound Name | 1-(4-methylcyclohexa-1,3-dien-1-yl)-N-propylbutane-1,4-diimine |
|---|---|
| PubChem CID | 134443678 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-(4-methylcyclohexa-1,3-dien-1-yl)-N-propylbutane-1,4-diimine |
| SMILES | [H]/N=C/CC/C(=N\CCC)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C14H22N2/c1-3-11-16-14(5-4-10-15)13-8-6-12(2)7-9-13/h6,8,10,15H,3-5,7,9,11H2,1-2H3/b15-10+,16-14+ |
| InChIKey | AASPXBSLUVOJAT-YITIUYSNSA-N |
| XLogP | 3.93 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|