About 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine
1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine (PubChem CID 134443699) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine.
Molecular Properties
| Compound Name | 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine |
| PubChem CID | 134443699 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine |
| SMILES | C/C=C\C(=C/N(N)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-7-8-11(12(4,5)6)9-14(13)10(2)3/h7-10H,13H2,1-6H3/b8-7-,11-9+ |
| InChIKey | NASCAZGWGSWJOT-NSXXKTIASA-N |
| XLogP | 3.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine?
The IUPAC name of 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine (CID 134443699) is 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine.
What is the SMILES notation for 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine?
The canonical SMILES for 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine is C/C=C\C(=C/N(N)C(C)C)C(C)(C)C.
What is the InChIKey of 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine?
The InChIKey is NASCAZGWGSWJOT-NSXXKTIASA-N. The full InChI is InChI=1S/C12H24N2/c1-7-8-11(12(4,5)6)9-14(13)10(2)3/h7-10H,13H2,1-6H3/b8-7-,11-9+.
What are the key properties of 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine?
1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine has a molecular weight of 196.34 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-1-propan-2-ylhydrazine is sourced from PubChem (CID 134443699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).