About N-ethenyl-2-imino-N'-methylethanimidamide
N-ethenyl-2-imino-N'-methylethanimidamide (PubChem CID 134444064) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is N-ethenyl-2-imino-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-2-imino-N'-methylethanimidamide |
| PubChem CID | 134444064 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | N-ethenyl-2-imino-N'-methylethanimidamide |
| SMILES | [H]/N=C/C(=N\C)NC=C |
| InChI | InChI=1S/C5H9N3/c1-3-8-5(4-6)7-2/h3-4,6H,1H2,2H3,(H,7,8)/b6-4+ |
| InChIKey | HDLULLIUKDNCEH-GQCTYLIASA-N |
| XLogP | 0.40 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-2-imino-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-2-imino-N'-methylethanimidamide?
The IUPAC name of N-ethenyl-2-imino-N'-methylethanimidamide (CID 134444064) is N-ethenyl-2-imino-N'-methylethanimidamide.
What is the SMILES notation for N-ethenyl-2-imino-N'-methylethanimidamide?
The canonical SMILES for N-ethenyl-2-imino-N'-methylethanimidamide is [H]/N=C/C(=N\C)NC=C.
What is the InChIKey of N-ethenyl-2-imino-N'-methylethanimidamide?
The InChIKey is HDLULLIUKDNCEH-GQCTYLIASA-N. The full InChI is InChI=1S/C5H9N3/c1-3-8-5(4-6)7-2/h3-4,6H,1H2,2H3,(H,7,8)/b6-4+.
What are the key properties of N-ethenyl-2-imino-N'-methylethanimidamide?
N-ethenyl-2-imino-N'-methylethanimidamide has a molecular weight of 111.15 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-2-imino-N'-methylethanimidamide is sourced from PubChem (CID 134444064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).