About 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene
5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene (PubChem CID 134444374) has the molecular formula C14H18O2S
and a molecular weight of 250.36 g/mol. Its IUPAC name is 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene |
| PubChem CID | 134444374 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene |
| SMILES | CCC1=CCC(S(=O)(=O)C2C=CC=CC2)C=C1 |
| InChI | InChI=1S/C14H18O2S/c1-2-12-8-10-14(11-9-12)17(15,16)13-6-4-3-5-7-13/h3-6,8-10,13-14H,2,7,11H2,1H3 |
| InChIKey | TUSRNSLTIUTIMI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene?
The IUPAC name of 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene (CID 134444374) is 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene.
What is the SMILES notation for 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene?
The canonical SMILES for 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene is CCC1=CCC(S(=O)(=O)C2C=CC=CC2)C=C1.
What is the InChIKey of 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene?
The InChIKey is TUSRNSLTIUTIMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2S/c1-2-12-8-10-14(11-9-12)17(15,16)13-6-4-3-5-7-13/h3-6,8-10,13-14H,2,7,11H2,1H3.
What are the key properties of 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene?
5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene has a molecular weight of 250.36 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-2,4-dien-1-ylsulfonyl-2-ethylcyclohexa-1,3-diene is sourced from PubChem (CID 134444374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).