C37H26NO2P — CID 134444480
1-dibenzofuran-4-yl-3-ethenyl-10-phenyl-2-[(Z)-prop-1-enyl]phosphindolo[3,2-g]indole 10-oxide (PubChem CID 134444480) has the molecular formula C37H26NO2P and a molecular weight of 547.59 g/mol. Its IUPAC name is 1-dibenzofuran-4-yl-3-ethenyl-10-phenyl-2-[(Z)-prop-1-enyl]phosphindolo[3,2-g]indole 10-oxide.
| Compound Name | 1-dibenzofuran-4-yl-3-ethenyl-10-phenyl-2-[(Z)-prop-1-enyl]phosphindolo[3,2-g]indole 10-oxide |
|---|---|
| PubChem CID | 134444480 |
| Molecular Formula | C37H26NO2P |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 1-dibenzofuran-4-yl-3-ethenyl-10-phenyl-2-[(Z)-prop-1-enyl]phosphindolo[3,2-g]indole 10-oxide |
| SMILES | C=Cc1c(/C=C\C)n(-c2cccc3c2oc2ccccc23)c2c3c(ccc12)-c1ccccc1P3(=O)c1ccccc1 |
| InChI | InChI=1S/C37H26NO2P/c1-3-13-31-25(4-2)28-22-23-30-27-17-9-11-21-34(27)41(39,24-14-6-5-7-15-24)37(30)35(28)38(31)32-19-12-18-29-26-16-8-10-20-33(26)40-36(29)32/h3-23H,2H2,1H3/b13-3- |
| InChIKey | IPSHEPNHKFVDTH-DXNYSGJVSA-N |
| XLogP | 8.83 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|